CAS 18807-74-4: N-Z-1,5-diaminopentane hydrochloride
Description:N-Z-1,5-diaminopentane hydrochloride, also known as 1,5-diaminopentane hydrochloride, is an organic compound characterized by its amine functional groups. It is a hydrochloride salt of 1,5-diaminopentane, which is a straight-chain aliphatic diamine. This compound typically appears as a white crystalline solid and is soluble in water due to the presence of the amine groups, which can engage in hydrogen bonding. The presence of two amino groups allows for potential reactivity in various chemical reactions, including those involving amine functionalities, such as acylation or alkylation. It is often used in biochemical applications, including as a building block in the synthesis of polymers, pharmaceuticals, and other organic compounds. Safety data sheets indicate that it should be handled with care, as with many amines, due to potential irritant properties. Proper storage conditions involve keeping it in a cool, dry place, away from incompatible substances.
Formula:C13H21ClN2O2
InChI:InChI=1/C13H20N2O2.ClH/c14-9-5-2-6-10-15-13(16)17-11-12-7-3-1-4-8-12;/h1,3-4,7-8H,2,5-6,9-11,14H2,(H,15,16);1H
- Synonyms:
- N-Carbobenzoxy-1,5-diaminopentane hydrochloride
- N-Z-1,5-pentanediamine hydrochloride
- benzyl N-(5-aminopentyl)carbamate hydrochloride
- N-Cbz-1,5-diaminopentane HCl
