CAS 188404-16-2: 1-methyl-2-(2-methylprop-2-en-1-yl)benzene
Description:1-Methyl-2-(2-methylprop-2-en-1-yl)benzene, also known as a derivative of styrene, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a methyl group and an allylic side chain. This compound features a branched alkene group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor, indicative of its aromatic nature. The presence of the double bond in the side chain allows for various chemical reactions, such as polymerization, making it useful in the production of polymers and resins. Additionally, its molecular structure suggests it may exhibit hydrophobic properties, influencing its solubility in organic solvents. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may pose health risks upon exposure. Overall, 1-methyl-2-(2-methylprop-2-en-1-yl)benzene is a valuable compound in the field of organic chemistry and materials science.
Formula:C11H14
InChI:InChI=1/C11H14/c1-9(2)8-11-7-5-4-6-10(11)3/h4-7H,1,8H2,2-3H3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Benzene, 1-methyl-2-(2-methyl-2-propen-1-yl)- REF: IN-DA002GVKCAS: 188404-16-2 | - - - | To inquire | Thu 27 Mar 25 |
![]() | 2-methyl-3-(2-methylphenyl)-1-propene REF: 10-F200123CAS: 188404-16-2 | 97.0% | - - - | Discontinued product |
![]() | 2-(2-Methylprop-2-en-1-yl)toluene REF: 3D-NHA40416CAS: 188404-16-2 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA002GVK
Undefined size | To inquire |

Ref: 10-F200123
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information |

2-(2-Methylprop-2-en-1-yl)toluene
Ref: 3D-NHA40416
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |