CAS 18906-40-6: 2-Chloro-5-(trifluoromethyl)benzenethiol
Description:2-Chloro-5-(trifluoromethyl)benzenethiol, with the CAS number 18906-40-6, is an organosulfur compound characterized by the presence of a thiol (-SH) group attached to a benzene ring that also features a chlorine atom and a trifluoromethyl group (-CF3). This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its strong odor, which is characteristic of thiols. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and stability, making it useful in various chemical applications, including as a building block in organic synthesis and in the development of pharmaceuticals. Additionally, the chlorine atom can participate in nucleophilic substitution reactions, further expanding its utility in synthetic chemistry. Due to the presence of both halogen and thiol functional groups, this compound may exhibit unique properties such as increased reactivity towards electrophiles and potential applications in materials science and agrochemicals.
Formula:C7H4ClF3S
InChI:InChI=1S/C7H4ClF3S/c8-5-2-1-4(3-6(5)12)7(9,10)11/h1-3,12H
InChI key:InChIKey=CLJUYSUDVRFKEL-UHFFFAOYSA-N
SMILES:FC(F)(F)C1=CC=C(Cl)C(S)=C1
- Synonyms:
- Benzenethiol, 2-chloro-5-(trifluoromethyl)-
- m-Toluenethiol, 6-chloro-α,α,α-trifluoro-
- 2-Chloro-5-(trifluoromethyl)benzenethiol
- 2-Chloro-5-(trifluoromethyl)benzene-1-thiol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Chloro-5-trifluoromethylbenzenethiol REF: 10-F037888CAS: 18906-40-6 | - - - | To inquire | Tue 08 Apr 25 |
![]() | 2-Chloro-5-trifluoromethylbenzenethiol REF: 3D-TAA90640CAS: 18906-40-6 | Min. 95% | To inquire | Thu 08 May 25 |

2-Chloro-5-trifluoromethylbenzenethiol
Ref: 10-F037888
1g | To inquire | ||
5g | To inquire |

2-Chloro-5-trifluoromethylbenzenethiol
Ref: 3D-TAA90640
1g | 1,250.00 € | ||
100mg | 493.00 € |