CAS 18999-43-4: 1-(2,2-Diethoxyethyl)-1H-imidazole
Description:1-(2,2-Diethoxyethyl)-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a diethoxyethyl substituent, which contributes to its solubility and reactivity. Typically, imidazole derivatives exhibit a range of biological activities, including antimicrobial and antifungal properties, making them of interest in pharmaceutical applications. The presence of the diethoxyethyl group enhances the compound's lipophilicity, potentially influencing its interaction with biological membranes. In terms of physical properties, compounds like this often have moderate boiling points and can be stable under standard conditions, although specific stability and reactivity can vary based on environmental factors. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions or coordination with metal ions, which can be relevant in synthetic chemistry and catalysis. Overall, 1-(2,2-Diethoxyethyl)-1H-imidazole represents a versatile structure with potential applications in medicinal chemistry and materials science.
Formula:C9H16N2O2
InChI:InChI=1S/C9H16N2O2/c1-3-12-9(13-4-2)7-11-6-5-10-8-11/h5-6,8-9H,3-4,7H2,1-2H3
InChI key:InChIKey=UQTQTELOLYOJRS-UHFFFAOYSA-N
SMILES:N=1C=CN(C1)CC(OCC)OCC
- Synonyms:
- 1-(2,2-Diethoxyethyl)imidazole
- 1H-Imidazole, 1-(2,2-diethoxyethyl)-
- 2-(2,2-diethoxyethyl)-1H-imidazole
- Imidazole-1-acetaldehyde, diethyl acetal
- 1-(2,2-Diethoxyethyl)-1H-imidazole
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1H-Imidazole, 1-(2,2-diethoxyethyl)- REF: IN-DA002E78CAS: 18999-43-4 | - - - | To inquire | Thu 27 Mar 25 |
 | 1-(2,2-diethoxyethyl)-1H-imidazole REF: 10-F375520CAS: 18999-43-4 | - - - | - - - | Discontinued product |
 | 1-(2,2-Diethoxyethyl)-1H-imidazole REF: 3D-FD133805CAS: 18999-43-4 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA002E78
| Undefined size | To inquire |
Ref: 10-F375520
| 10g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information |
1-(2,2-Diethoxyethyl)-1H-imidazole
Ref: 3D-FD133805
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
