CAS 191605-10-4: (S,S)-Di-p-anisoyltartaric acid
Description:(S,S)-Di-p-anisoyltartaric acid is a chiral compound that belongs to the class of tartaric acid derivatives. It is characterized by the presence of two p-anisoyl groups attached to the tartaric acid backbone, which contributes to its stereochemical properties. This compound is typically utilized in asymmetric synthesis and as a chiral auxiliary in various chemical reactions, particularly in the production of enantiomerically pure compounds. The presence of the p-anisoyl groups enhances its solubility in organic solvents, making it suitable for various applications in organic chemistry. Additionally, (S,S)-Di-p-anisoyltartaric acid exhibits specific optical activity due to its chiral nature, allowing it to interact differently with polarized light. Its ability to form stable complexes with metal ions further expands its utility in catalysis and material science. Overall, this compound is significant in the field of stereochemistry and plays a crucial role in the development of chiral drugs and other fine chemicals.
Formula:C20H18O10
InChI:InChI=1S/C20H18O10/c1-27-13-7-3-11(4-8-13)19(25)29-15(17(21)22)16(18(23)24)30-20(26)12-5-9-14(28-2)10-6-12/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24)/t15-,16-/m0/s1
InChI key:InChIKey=KWWCVCFQHGKOMI-HOTGVXAUSA-N
SMILES:O=C(OC(C(=O)O)C(OC(=O)C1=CC=C(OC)C=C1)C(=O)O)C2=CC=C(OC)C=C2
- Synonyms:
- (2S,3S)-(+)-Di(p-anisoyl)tartaric acid
- (2S,3S)-2,3-bis[(4-methoxybenzoyl)oxy]butanedioic acid
- (S,S)-Di-p-anisoyltartaric acid
- 2,3-Bis[(4-Methoxybenzoyl)Oxy]Butanedioic Acid
- Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, (2S,3S)-
- Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, [S-(R*,R*)]-
- Di(+)-(p-anisoyl)-<span class="text-smallcaps">D</span>-tartrate
- Di-P-Anisoyl-D-Tartaric Acid
![Butanedioic acid, 2,3-bis[(4-methoxybenzoyl)oxy]-, (2S,3S)-](https://static.cymitquimica.com/products/IN/thumb/DA002FCY.jpg)
