CAS 19413-49-1: etiohemin
Description:Etiohemin is a chemical compound that belongs to the class of porphyrins, specifically a derivative of heme. It is characterized by its complex cyclic structure, which includes a porphyrin ring with various substituents that influence its chemical properties and biological activity. The compound is known for its role in biological systems, particularly in relation to heme metabolism and its potential applications in biochemistry and medicine. Etiohemin can exhibit coordination chemistry, allowing it to bind metal ions, which is significant for its function in biological processes. Additionally, it may possess antioxidant properties and has been studied for its effects on various biological pathways. The compound is typically soluble in organic solvents and may have limited solubility in water, which is common for many porphyrin derivatives. Its unique structure and properties make it a subject of interest in research related to enzymatic reactions, drug development, and the study of metabolic disorders involving heme.
Formula:C32H36ClFeN4
InChI:InChI=1/C32H36N4.ClH.Fe/c1-9-21-17(5)25-14-30-23(11-3)19(7)27(35-30)16-32-24(12-4)20(8)28(36-32)15-31-22(10-2)18(6)26(34-31)13-29(21)33-25;;/h13-16H,9-12H2,1-8H3;1H;/q-2;;+3/p-1/b25-14-,26-13-,27-16-,28-15-,29-13-,30-14-,31-15-,32-16-;;
- Synonyms:
- Etiohemin
- Etiohemin I
- iron(3+) chloride 2,7,12,17-tetraethyl-3,8,13,18-tetramethylporphine-21,22-diide
- Iron, chloro(2,7,12,17-tetraethyl-3,8,13,18-tetramethyl-21H,23H-porphinato(2-)-N21,N22,N23,N24)-, (SP-5-12)-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Fe (III) Etioporphyrin I chloride REF: FT-E40049CAS: 19413-49-1 | >95% | To inquire | Tue 01 Apr 25 |