CAS 1956370-89-0: 3-Pyridinecarboxylic acid, 4-bromo-, hydrochloride (1:1)

Description:3-Pyridinecarboxylic acid, 4-bromo-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group at the 3-position and a bromine substituent at the 4-position of the pyridine ring. The hydrochloride form indicates that the compound is in a salt form, where the carboxylic acid is protonated and paired with a chloride ion. This substance is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its properties include solubility in water due to the presence of the hydrochloride, which enhances its ionic character. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Pyridinecarboxylic acid, 4-bromo-, hydrochloride is a versatile compound with applications in various chemical research fields.

Formula:C₆H₄BrNO₂·ClH

InChI:InChI=1S/C6H4BrNO2.ClH/c7-5-1-2-8-3-4(5)6(9)10;/h1-3H,(H,9,10);1H

InChI key:InChIKey=VGKFBRFKLOLPLB-UHFFFAOYSA-N

SMILES:Cl.O=C(O)C=1C=NC=CC1Br