CAS 19652-33-6: 5-Bromo-3-chloro-2-hydroxybenzaldehyde

Description:5-Bromo-3-chloro-2-hydroxybenzaldehyde, with the CAS number 19652-33-6, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a hydroxyl group (-OH), a bromine atom, and a chlorine atom attached to the benzene ring, contributing to its unique reactivity and properties. The presence of these halogen substituents can influence the compound's polarity, solubility, and potential for hydrogen bonding. Typically, such compounds exhibit moderate to high reactivity due to the electrophilic nature of the aldehyde group and the electron-withdrawing effects of the halogens. This substance may be utilized in various chemical syntheses, particularly in the development of pharmaceuticals or agrochemicals, owing to its functional groups that can participate in further chemical reactions. Additionally, its physical properties, such as melting point and boiling point, would be influenced by the substituents and the overall molecular structure, making it an interesting compound for study in organic chemistry.

Formula:C₇H₄BrClO₂

InChI:InChI=1S/C7H4BrClO2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H

InChI key:InChIKey=XXFFEGBFFXHMTF-UHFFFAOYSA-N

SMILES:O=CC=1C=C(Br)C=C(Cl)C1O

Synonyms:
Salicylaldehyde, 5-bromo-3-chloro-
5-Bromo-3-chlorosalicylaldehyde
5-Bromo-3-chloro-2-hydroxybenzaldehyde
Benzaldehyde, 5-bromo-3-chloro-2-hydroxy-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-bromo-3-chloro-2-hydroxybenzaldehyde REF: IN-DA00AN8SCAS: 19652-33-6	95%	To inquire	Thu 27 Mar 25
5-Bromo-3-chloro-2-hydroxybenzaldehyde REF: 54-OR54699CAS: 19652-33-6	≥95.0% (1h-nmr) (Typical Value in Batch COA)	127.00 €~290.00 €	Fri 28 Mar 25
5-Bromo-3-chloro-2-hydroxybenzaldehyde REF: 10-F464360CAS: 19652-33-6	95.0%	40.00 €~1,646.00 €	Tue 01 Apr 25
5-Bromo-3-chloro-2-hydroxybenzaldehyde REF: 3D-UAA65233CAS: 19652-33-6	Min. 95%	To inquire	Thu 08 May 25