CAS 196601-69-1: (R)-2-Amino-N-benzyl-3-methoxypropionamide
Description:(R)-2-Amino-N-benzyl-3-methoxypropionamide is an organic compound characterized by its chiral amine structure, which includes an amino group, a benzyl substituent, and a methoxy group attached to a propionamide backbone. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and stability under standard conditions. The presence of the benzyl group contributes to its lipophilicity, while the methoxy group can influence its reactivity and interaction with biological systems. As a chiral molecule, it may exhibit enantioselective behavior in chemical reactions and biological activity, making it of interest in pharmaceutical applications. The compound's specific stereochemistry can affect its pharmacokinetics and pharmacodynamics, which is crucial for drug development. Additionally, it may participate in hydrogen bonding due to the amino and carbonyl functionalities, impacting its physical properties and interactions with other molecules. Overall, (R)-2-Amino-N-benzyl-3-methoxypropionamide is a compound of interest in medicinal chemistry and related fields.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-15-8-10(12)11(14)13-7-9-5-3-2-4-6-9/h2-6,10H,7-8,12H2,1H3,(H,13,14)/t10-/m1/s1
InChI key:InChIKey=WPLANNRKFDHEKD-SNVBAGLBSA-N
SMILES:O=C(NCC=1C=CC=CC1)C(N)COC
- Synonyms:
- (2R)-2-Amino-3-methoxy-N-(phenylmethyl)propanamide
- (2R)-2-Amino-N-benzyl-3-methoxypropanamide
- (R)-2-Amino-N-benzyl-3-methoxypropionamide
- N-Benzyl-O-methyl-D-serinamide
- Propanamide, 2-amino-3-methoxy-N-(phenylmethyl)-, (R)-
- propanamide, 2-amino-3-methoxy-N-(phenylmethyl)-, (2R)-
