CAS 19672-60-7: 2,4'-DICHLOROCHALCONE

Description:2,4'-Dichlorochalcone is an organic compound belonging to the chalcone family, characterized by its structure, which consists of two aromatic rings connected by a three-carbon α,β-unsaturated carbonyl system. The presence of two chlorine atoms at the 2 and 4' positions of the aromatic rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. This compound typically appears as a yellow solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. 2,4'-Dichlorochalcone has garnered interest in various fields, including medicinal chemistry, due to its potential as an antimicrobial and anticancer agent. Its reactivity can be attributed to the α,β-unsaturated carbonyl group, which can participate in various chemical reactions, including Michael additions and condensation reactions. Additionally, the compound's structural features allow for the exploration of its derivatives, which may exhibit enhanced biological activities or altered physicochemical properties. Overall, 2,4'-Dichlorochalcone serves as a valuable compound for research in organic synthesis and pharmacology.

Formula:C₁₅H₁₀Cl₂O

InChI:InChI=1/C15H10Cl2O/c16-13-8-5-12(6-9-13)15(18)10-7-11-3-1-2-4-14(11)17/h1-10H/b10-7+