CAS 19808-30-1: 5-Bromo-4(3H)-pyrimidinone
Description:5-Bromo-4(3H)-pyrimidinone is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains a bromine atom at the 5-position and a keto group at the 4-position. This compound typically appears as a crystalline solid and is soluble in polar solvents such as water and alcohols. Its molecular structure contributes to its potential reactivity, particularly in nucleophilic substitution reactions due to the presence of the bromine atom, which can be replaced by various nucleophiles. The keto group can also participate in tautomeric shifts, influencing its chemical behavior. 5-Bromo-4(3H)-pyrimidinone is of interest in medicinal chemistry and pharmaceutical research, as derivatives of pyrimidinones often exhibit biological activity, including antiviral and anticancer properties. Additionally, its unique structural features make it a valuable intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C4H3BrN2O
InChI:InChI=1S/C4H3BrN2O/c5-3-1-6-2-7-4(3)8/h1-2H,(H,6,7,8)
InChI key:InChIKey=CLJIGLPOBRSBNU-UHFFFAOYSA-N
SMILES:O=C1NC=NC=C1Br
- Synonyms:
- 4(1H)-Pyrimidinone, 5-bromo-
- 4(3H)-Pyrimidinone, 5-bromo-
- 4-Pyrimidinol, 5-bromo-
- 5-Bromo-1H-pyrimidin-6-one
- 5-Bromo-3,4-Dihydropyrimidin-4-One
- 5-Bromo-4(1H)-pyrimidinone
- 5-Bromo-4(3H)-pyrimidinone
- 5-Bromo-4-hydroxypyrimidine
- 5-Bromopyrimidin-4(1H)-one
- 5-Bromopyrimidin-4-ol
- See more synonyms
- 5-bromopyrimidin-4(3H)-one
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4(3H)-Pyrimidinone, 5-bromo- REF: IN-DA002BAFCAS: 19808-30-1 | 98% | 26.00 €~549.00 € | Thu 27 Mar 25 |
 | 5-Bromopyrimidin-4-ol REF: 54-OR480748CAS: 19808-30-1 | 98% | 113.00 €~308.00 € | Thu 03 Apr 25 |
 | 5-Bromopyrimidin-4-ol REF: 10-F076066CAS: 19808-30-1 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 5-Bromopyrimidin-4(1H)-one REF: 3D-FB140694CAS: 19808-30-1 | Min. 95% | - - - | Discontinued product |
4(3H)-Pyrimidinone, 5-bromo-
Ref: IN-DA002BAF
| 1g | 35.00 € | ||
| 5g | 66.00 € | ||
| 10g | 102.00 € | ||
| 25g | 149.00 € | ||
| 100g | 549.00 € | ||
| 250mg | 26.00 € |
5-Bromopyrimidin-4-ol
Ref: 54-OR480748
| 25g | 308.00 € |
5-Bromopyrimidin-4(1H)-one
Ref: 3D-FB140694
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
