CAS 20069-28-7: [(pyrrolidin-1-ylcarbothioyl)sulfanyl]acetic acid

Description:[(Pyrrolidin-1-ylcarbothioyl)sulfanyl]acetic acid, with the CAS number 20069-28-7, is a chemical compound that features a pyrrolidine ring, a thiocarbonyl group, and a carboxylic acid functional group. This compound is characterized by its potential biological activity, which may include antimicrobial or anti-inflammatory properties, although specific studies may be required to confirm these effects. The presence of the pyrrolidine moiety suggests that it may exhibit unique steric and electronic properties, influencing its reactivity and interactions with biological targets. The thiol and carboxylic acid functionalities contribute to its potential as a ligand in coordination chemistry or as a precursor in organic synthesis. Additionally, the compound's solubility and stability can be influenced by the presence of these functional groups, making it of interest in various chemical and pharmaceutical applications. Overall, [(pyrrolidin-1-ylcarbothioyl)sulfanyl]acetic acid represents a versatile structure that may serve as a valuable tool in medicinal chemistry and related fields.

Formula:C₇H₁₁NO₂S₂

InChI:InChI=1/C7H11NO2S2/c9-6(10)5-12-7(11)8-3-1-2-4-8/h1-5H2,(H,9,10)

Synonyms:
[(Pyrrolidin-1-Ylcarbonothioyl)Thio]Acetic Acid
Acetic acid, 2-[(1-pyrrolidinylthioxomethyl)thio]-
[(Pyrrolidin-1-ylcarbothioyl)sulfanyl]acetic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Acetic acid, 2-[(1-pyrrolidinylthioxomethyl)thio]- REF: IN-DA002CWXCAS: 20069-28-7	95%	To inquire	Thu 27 Mar 25
2-(Pyrrolidine-1-carbothioylsulfanyl)acetic acid REF: 54-OR82905CAS: 20069-28-7	95%	147.00 €~226.00 €	Fri 28 Mar 25
2-(Pyrrolidine-1-carbothioylsulfanyl)acetic acid REF: 10-F650820CAS: 20069-28-7	97%	To inquire	Tue 08 Apr 25
2-(Pyrrolidine-1-carbothioylsulfanyl)acetic acid REF: 3D-VAA06928CAS: 20069-28-7	Min. 95%	To inquire	Thu 08 May 25