CAS 20165-96-2: N,N-diethylpyridine-3-carboxamide 1-oxide

Description: N,N-Diethylpyridine-3-carboxamide 1-oxide, with the CAS number 20165-96-2, is a chemical compound characterized by its pyridine ring structure, which is substituted with a carboxamide group and two ethyl groups. This compound typically exhibits properties associated with both amides and pyridine derivatives, including moderate polarity and potential solubility in polar organic solvents. The presence of the 1-oxide functional group suggests that it may have unique reactivity and stability characteristics, potentially influencing its behavior in chemical reactions and interactions with biological systems. As a pyridine derivative, it may also exhibit basic properties, allowing it to participate in various chemical processes. Additionally, compounds of this nature can be of interest in medicinal chemistry and agricultural applications due to their potential biological activity. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any risks associated with exposure or environmental impact.

Formula: C₁₀H₁₄N₂O₂

InChI: InChI=1/C10H14N2O2/c1-3-11(4-2)10(13)9-6-5-7-12(14)8-9/h5-8H,3-4H2,1-2H3

3-Pyridinecarboxamide, N,N-diethyl-, 1-oxide

CAS: 20165-96-2

• Formula: C₁₀H₁₄N₂O₂
• Purity: 98%
• Color and Shape: Solid
• Molecular weight: 194.2304

N,N-Diethylnicotinamide (Nikethamide) N'-oxide

CAS: 20165-96-2

• Formula: C₁₀H₁₄N₂O₂
• Molecular weight: 194.23