CAS 201849-16-3: 1-bromo-5-chloro-3-fluoro-2-iodo-benzene

Description:1-Bromo-5-chloro-3-fluoro-2-iodo-benzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. The compound features a bromine atom at the first position, a chlorine atom at the fifth position, a fluorine atom at the third position, and an iodine atom at the second position of the benzene ring. This complex substitution pattern can influence its chemical reactivity, polarity, and overall stability. The presence of various halogens typically enhances the compound's reactivity in nucleophilic substitution reactions and can affect its solubility in different solvents. Additionally, the differing electronegativities of the halogens contribute to the compound's dipole moment, potentially impacting its interactions with other molecules. Such compounds are often of interest in organic synthesis and materials science due to their unique properties and potential applications in pharmaceuticals, agrochemicals, and as intermediates in chemical reactions. Safety precautions should be taken when handling this compound, as halogenated compounds can be toxic and environmentally hazardous.

Formula:C₆H₂BrClFI

InChI:InChI=1/C6H2BrClFI/c7-4-1-3(8)2-5(9)6(4)10/h1-2H

Synonyms:
1-Bromo-5-chloro-3-fluoro-2-iodobenzene
Benzene, 1-bromo-5-chloro-3-fluoro-2-iodo-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzene, 1-bromo-5-chloro-3-fluoro-2-iodo- REF: IN-DA0027VUCAS: 201849-16-3	97%	26.00 €~558.00 €	Thu 27 Mar 25
1-Bromo-5-chloro-3-fluoro-2-iodobenzene REF: 10-F024653CAS: 201849-16-3	96.0%	24.00 €~185.00 €	Tue 01 Apr 25
1-Bromo-5-chloro-3-fluoro-2-iodobenzene REF: 54-PC902929CAS: 201849-16-3	98%	167.00 €~400.00 €	Thu 03 Apr 25
1-Bromo-5-chloro-3-fluoro-2-iodobenzene REF: 3D-FB64553CAS: 201849-16-3	Min. 95%	- - -	Discontinued product