CAS 202126-51-0: 5-hexyl-[1,3]dithiolo[4,5-d][1,3]dithiole-2-thione

Description:5-Hexyl-[1,3]dithiolo[4,5-d][1,3]dithiole-2-thione is a sulfur-containing organic compound characterized by its unique dithiolo structure, which includes multiple sulfur atoms in its framework. This compound typically exhibits properties associated with dithioles, such as potential electron-donating capabilities and interesting redox behavior. The presence of the hexyl group contributes to its hydrophobic nature, influencing its solubility in organic solvents rather than in water. The compound may display interesting optical and electronic properties, making it of interest in materials science and organic electronics. Additionally, its structure suggests potential applications in organic synthesis and as a building block for more complex molecules. The thione functional group indicates that it may participate in various chemical reactions, including nucleophilic attacks and coordination with metal ions. Overall, 5-hexyl-[1,3]dithiolo[4,5-d][1,3]dithiole-2-thione is a compound of interest for researchers exploring sulfur chemistry and its applications in various fields.

Formula:C₁₀H₁₄S₅

InChI:InChI=1/C10H14S5/c1-2-3-4-5-6-7-12-8-9(13-7)15-10(11)14-8/h7H,2-6H2,1H3

Synonyms:
1,3-Dithiolo[4,5-D][1,3]Dithiole-2-Thione, 5-Hexyl-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
5-Hexyl-1,3-dithiolo[4,5-d][1,3]dithiole-2-thione REF: 3B-H1163CAS: 202126-51-0	>98.0%(HPLC)	379.00 €	Thu 20 Mar 25
[1,3]Dithiolo[4,5-d]-1,3-dithiole-2-thione, 5-hexyl- REF: IN-DA00282GCAS: 202126-51-0	- - -	To inquire	Thu 27 Mar 25
5-Hexyl-[1,3]dithiolo[4,5-d][1,3]dithiole-2-thione REF: 10-F759979CAS: 202126-51-0	97%	To inquire	Tue 08 Apr 25
5-Hexyl-1,3-dithiolo[4,5-d][1,3]dithiole-2-thione REF: 3D-FH61928CAS: 202126-51-0	Min. 95%	- - -	Discontinued product