CAS 20217-04-3

2-[(2,4-dimethylphenoxy)methyl]oxirane

Description:

2-[(2,4-Dimethylphenoxy)methyl]oxirane, with the CAS number 20217-04-3, is an organic compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a phenoxy group substituted with two methyl groups at the 2 and 4 positions of the aromatic ring, contributing to its hydrophobic characteristics. The presence of the oxirane ring indicates that it can participate in various chemical reactions, including ring-opening reactions, which are significant in polymer chemistry and synthesis of more complex molecules. The compound is likely to exhibit moderate to low solubility in water due to its hydrophobic aromatic structure, while being more soluble in organic solvents. Its unique structure may impart specific reactivity and stability under various conditions, making it of interest in fields such as materials science and organic synthesis. Safety data should be consulted for handling and potential hazards, as compounds with epoxide groups can be reactive and may pose health risks.

Formula: C₁₁H₁₄O₂

InChI: InChI=1/C11H14O2/c1-8-3-4-11(9(2)5-8)13-7-10-6-12-10/h3-5,10H,6-7H2,1-2H3

SMILES: Cc1ccc(c(C)c1)OCC1CO1

2-((2,4-Dimethylphenoxy)methyl)oxirane

CAS: 20217-04-3

Formula: C₁₁H₁₄O₂

Molecular weight: 178.2277

Ref: IN-DA00283K

2-(2,4-Dimethylphenoxymethyl)oxirane

CAS: 20217-04-3

2-(2,4-Dimethylphenoxymethyl)oxirane is a heterocyclic compound with the molecular formula C9H10O. It has a benzamide conformation and crystallizes in the orthorhombic system. The molecule's cell parameters are a = 8.867 Å, b = 5.449 Å, c = 5.552 Å, and β = 120°. 2-(2,4-Dimethylphenoxymethyl)oxirane has been shown to form supramolecular complexes with other molecules such as ethylbenzene and 1-chloro-3-methylbenzene. These complexes have been shown to have alkaline hydrolysis properties that may be useful for industrial applications such as alkylation or nucleophilic substitution reactions in organic synthesis processes. 2-(2,4-Dimethylphenoxymethyl)oxirane has also been shown to react with chlorine gas to

Formula: C₁₁H₁₄O₂

Purity: Min. 95%

Molecular weight: 178.23 g/mol

Ref: 3D-VAA21704