CAS 20279-44-1: Butyl Pyruvate
Description:Butyl pyruvate is an ester formed from the reaction of butanol and pyruvic acid. It is characterized by its molecular structure, which includes a butyl group attached to the pyruvate moiety. This compound typically appears as a colorless to pale yellow liquid with a fruity odor. It is soluble in organic solvents and has limited solubility in water, which is common for many esters. Butyl pyruvate is often used in organic synthesis and as a flavoring agent due to its pleasant aroma. Additionally, it may serve as an intermediate in the production of various chemicals. The compound's properties, such as boiling point and density, can vary based on environmental conditions and purity. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Proper storage in a cool, dry place away from incompatible materials is recommended to maintain its stability and efficacy.
Formula:C7H12O3
InChI:InChI=1/C7H12O3/c1-3-4-5-10-7(9)6(2)8/h3-5H2,1-2H3
- Synonyms:
- butyl 2-oxopropanoate
- N,N-Dimethylcarbamic Acid 3-Pyridinyl Ester
- pyruvic acid butyl ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Propanoic acid, 2-oxo-, butyl ester REF: IN-DA0028ESCAS: 20279-44-1 | - - - | To inquire | Thu 27 Mar 25 |
 | butyl 2-hydroxyprop-2-enoate REF: 10-F771827CAS: 20279-44-1 | 98% | - - - | Discontinued product |
 | Butyl 2-oxopropanoate REF: 3D-VAA27944CAS: 20279-44-1 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA0028ES
| Undefined size | To inquire |
Ref: 10-F771827
| 500g | Discontinued | Request information |
Butyl 2-oxopropanoate
Ref: 3D-VAA27944
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 50g | Discontinued | Request information | |
| 100mg | Discontinued | Request information |
