CAS 202865-82-5: 1-(3-Bromo-4-fluorophenyl)-1-propanone

Description:1-(3-Bromo-4-fluorophenyl)-1-propanone, with the CAS number 202865-82-5, is an organic compound characterized by its ketone functional group and a substituted phenyl ring. The presence of both bromine and fluorine atoms on the aromatic ring contributes to its unique reactivity and physical properties. Typically, compounds like this exhibit moderate to high polarity due to the electronegative halogen substituents, which can influence their solubility in various solvents. The bromine atom can enhance the compound's electrophilic character, making it useful in various synthetic applications, including medicinal chemistry and material science. Additionally, the ketone group can participate in nucleophilic addition reactions, further expanding its utility in organic synthesis. The compound's structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, handling and usage should be approached with caution due to the presence of halogens, which can pose environmental and health risks.

Formula:C₉H₈BrFO

InChI:InChI=1S/C9H8BrFO/c1-2-9(12)6-3-4-8(11)7(10)5-6/h3-5H,2H2,1H3

InChI key:InChIKey=IZSXDWBFACKNSW-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(F)C(Br)=C1)CC

Synonyms:
1-(3-Bromo-4-fluorophenyl)-1-propanone
1-(3-Bromo-4-fluorophenyl)propan-1-one
1-Propanone, 1-(3-Bromo-4-Fluorophenyl)-
3-Bromo-4-fluoropropiophenone

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1-Propanone, 1-(3-bromo-4-fluorophenyl)- REF: IN-DA0028I5CAS: 202865-82-5	- - -	To inquire	Thu 27 Mar 25
3'-Bromo-4'-fluoropropiophenone REF: 54-PC7411CAS: 202865-82-5	98%	115.00 €	Fri 28 Mar 25
1-(3-Bromo-4-fluorophenyl)propan-1-one REF: 10-F723432CAS: 202865-82-5	98%	- - -	Discontinued product
3'-Bromo-4'-Fluoropropiophenone REF: 3D-FB80158CAS: 202865-82-5	Min. 95%	- - -	Discontinued product