CAS 20348-23-6: 3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine

Description:3,4-Dihydro-2H-pyrido[3,2-b][1,4]oxazine is a heterocyclic organic compound characterized by its bicyclic structure, which includes a pyridine and an oxazine ring. This compound features a nitrogen atom in the pyridine ring and an oxygen atom in the oxazine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of both nitrogen and oxygen in its structure can impart basic and nucleophilic characteristics, making it potentially reactive in various chemical reactions. Additionally, compounds of this type may exhibit biological activity, which could be of interest in medicinal chemistry. Its CAS number, 20348-23-6, allows for precise identification in chemical databases. Overall, 3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine is notable for its structural complexity and potential applications in various fields, including pharmaceuticals and materials science.

Formula:C₇H₈N₂O

InChI:InChI=1/C7H8N2O/c1-2-6-7(8-3-1)9-4-5-10-6/h1-3H,4-5H2,(H,8,9)

Synonyms:
2H-Pyrido[3,2-b]-1,4-oxazine, 3,4-dihydro-

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2H-Pyrido[3,2-b]-1,4-oxazine, 3,4-dihydro- REF: IN-DA0028WOCAS: 20348-23-6	97%	24.00 €~470.00 €	Thu 27 Mar 25
3,4-Dihydro-2H-pyrido[3,2-b][1,4]oxazine REF: 54-OR315044CAS: 20348-23-6	96%	75.00 €~273.00 €	Fri 28 Mar 25
3,4-dihydro-2H-pyrido[3,2-b][1,4]oxazine REF: TM-Fr16627CAS: 20348-23-6	98.87% - ≥98%	41.00 €~116.00 €	Tue 01 Apr 25
3,4-Dihydro-2H-pyrido[3,2-b][1,4]oxazine REF: 10-F236637CAS: 20348-23-6	95.0%	To inquire	Tue 08 Apr 25
3,4-Dihydro-2H-pyrido[3,2-b][1,4]oxazine REF: 3D-FD76081CAS: 20348-23-6	Min. 95%	- - -	Discontinued product