CAS 203506-01-8: 6-bromo-3-methylquinolin-2-amine

Description:6-Bromo-3-methylquinolin-2-amine is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methyl group at the 3-position of the quinoline ring contributes to its unique chemical properties. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its aromatic nature. It may participate in various chemical reactions, such as electrophilic substitutions due to the electron-rich nature of the quinoline ring. Additionally, the amino group at the 2-position can act as a nucleophile, making it reactive in coupling reactions or as a ligand in coordination chemistry. The compound's structure suggests potential biological activity, which may be explored in medicinal chemistry for its pharmacological properties. As with many brominated compounds, it may also exhibit specific environmental and safety considerations, necessitating careful handling and disposal in laboratory settings.

Formula:C₁₀H₉BrN₂

InChI:InChI=1/C10H9BrN2/c1-6-4-7-5-8(11)2-3-9(7)13-10(6)12/h2-5H,1H3,(H2,12,13)

Synonyms:
2-Quinolinamine, 6-Bromo-3-Methyl-
6-Bromo-3-methylquinolin-2-amine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Quinolinamine, 6-bromo-3-methyl- REF: IN-DA0028X6CAS: 203506-01-8	97%	To inquire	Thu 27 Mar 25
6-Bromo-3-methyl-quinolin-2-amine REF: 10-F719260CAS: 203506-01-8	98%	94.00 €~1,300.00 €	Tue 01 Apr 25
2-Amino-6-bromo-3-methylquinoline REF: 54-OR3650CAS: 203506-01-8	95%	786.00 €	Thu 03 Apr 25
2-Amino-6-bromo-3-methylquinoline REF: 3D-FA07926CAS: 203506-01-8	Min. 95%	- - -	Discontinued product