CAS 203626-59-9: 4-Hydroxy-3,5-dinitrobenzenepropanoic acid hydrazide

Description:4-Hydroxy-3,5-dinitrobenzenepropanoic acid hydrazide, with the CAS number 203626-59-9, is a chemical compound characterized by its hydrazide functional group, which is linked to a dinitro-substituted aromatic ring. This compound typically exhibits properties associated with both hydrazides and nitroaromatic compounds, including potential reactivity due to the presence of the nitro groups, which can influence its chemical behavior and interactions. The hydroxyl group contributes to its solubility in polar solvents and may also participate in hydrogen bonding. The presence of the propanoic acid moiety suggests that it may exhibit acidic properties, potentially allowing for proton transfer reactions. This compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. However, specific applications and safety considerations would depend on further research and characterization. As with many nitro compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact.

Formula:C₉H₁₀N₄O₆

InChI:InChI=1S/C9H10N4O6/c10-11-8(14)2-1-5-3-6(12(16)17)9(15)7(4-5)13(18)19/h3-4,15H,1-2,10H2,(H,11,14)

InChI key:InChIKey=ISBULOLECAVIPN-UHFFFAOYSA-N

SMILES:O=C(NN)CCC=1C=C(C(O)=C(C1)N(=O)=O)N(=O)=O