CAS 2039-77-2: 9-Acetylphenanthrene

Description:9-Acetylphenanthrene is an organic compound characterized by its structure, which consists of a phenanthrene backbone with an acetyl group attached at the 9-position. This compound is typically a yellow to brown solid at room temperature and is known for its aromatic properties due to the presence of multiple fused benzene rings. It is relatively insoluble in water but soluble in organic solvents such as ethanol and acetone. 9-Acetylphenanthrene can undergo various chemical reactions, including electrophilic substitution and reduction, making it useful in organic synthesis and as an intermediate in the production of dyes and pharmaceuticals. Additionally, it exhibits fluorescence, which can be exploited in various applications, including materials science and photonics. Safety data indicates that, like many aromatic compounds, it should be handled with care due to potential health risks associated with exposure. Overall, 9-acetylphenanthrene is a significant compound in organic chemistry with various applications in research and industry.

Formula:C₁₆H₁₂O

InChI:InChI=1S/C16H12O/c1-11(17)16-10-12-6-2-3-7-13(12)14-8-4-5-9-15(14)16/h2-10H,1H3

InChI key:InChIKey=UIFAWZBYTTXSOG-UHFFFAOYSA-N

SMILES:O=C(C1=CC=2C=CC=CC2C=3C=CC=CC31)C

Synonyms:
1-(9-Phenanthrenyl)ethanone
1-(Phenanthren-9-Yl)Ethanone
Ethanone, 1-(9-phenanthrenyl)-
Ketone, methyl 9-phenanthryl
Methyl 9-Phenanthryl Ketone
NSC 15306
NSC 231776
9-Acetylphenanthrene

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Ethanone, 1-(9-phenanthrenyl)- REF: IN-DA00296BCAS: 2039-77-2	98%	To inquire	Thu 27 Mar 25
1-(Phenanthren-9-yl)ethan-1-one REF: 54-OR93065CAS: 2039-77-2	95%	148.00 €~2,222.00 €	Fri 28 Mar 25
1-(Phenanthren-9-yl)ethan-1-one REF: 10-F982764CAS: 2039-77-2	- - -	To inquire	Tue 08 Apr 25
9-Acetylphenanthrene REF: 3D-FA67349CAS: 2039-77-2	Min. 95%	153.00 €~876.00 €	Mon 07 Apr 25