CAS 2045-25-2: 4-(4-Morpholinyl)-1,3,5-triazin-2-amine
Description:4-(4-Morpholinyl)-1,3,5-triazin-2-amine, with the CAS number 2045-25-2, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features a morpholine group, which is a cyclic amine, contributing to its unique properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the morpholine moiety. The triazine structure can participate in various chemical reactions, making it useful in synthetic chemistry and potentially in agrochemical applications. Its amine functional group can engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the compound may exhibit biological activity, although specific pharmacological properties would require further investigation. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance. Overall, 4-(4-Morpholinyl)-1,3,5-triazin-2-amine is a versatile compound with potential applications in various fields.
Formula:C7H11N5O
InChI:InChI=1S/C7H11N5O/c8-6-9-5-10-7(11-6)12-1-3-13-4-2-12/h5H,1-4H2,(H2,8,9,10,11)
InChI key:InChIKey=QEJUSHCHCOTTPE-UHFFFAOYSA-N
SMILES:N=1C=NC(=NC1N)N2CCOCC2
- Synonyms:
- 1,3,5-Triazin-2-Amine, 4-(4-Morpholinyl)-
- 2-Amino-4-morpholino-s-triazine
- 4-(4-Morpholinyl)-1,3,5-triazin-2-amine
- NSC 109885
- s-Triazine, 2-amino-4-morpholino-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 1,3,5-Triazin-2-amine, 4-(4-morpholinyl)- REF: IN-DA0029JICAS: 2045-25-2 | 97% | 165.00 €~326.00 € | Thu 27 Mar 25 |
 | 4-(4-morpholinyl)-1,3,5-triazin-2-amine REF: 10-F310931CAS: 2045-25-2 | 95.0% | To inquire | Tue 08 Apr 25 |
 | 4-Morpholin-4-yl-1,3,5-triazin-2-amine REF: 3D-FM125731CAS: 2045-25-2 | Min. 95% | - - - | Discontinued product |
1,3,5-Triazin-2-amine, 4-(4-morpholinyl)-
Ref: IN-DA0029JI
| 1g | 326.00 € | ||
| 250mg | 165.00 € |
4-(4-morpholinyl)-1,3,5-triazin-2-amine
Ref: 10-F310931
| 1g | 211.00 € | ||
| 250mg | 90.00 € |
4-Morpholin-4-yl-1,3,5-triazin-2-amine
Ref: 3D-FM125731
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
