CAS 2055-97-2: 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzoic acid

Description:4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodobenzoic acid, with the CAS number 2055-97-2, is an organic compound characterized by its complex structure featuring multiple iodine substituents and a phenolic hydroxyl group. This compound belongs to the class of iodinated benzoic acids, which are known for their potential applications in medicinal chemistry and as contrast agents in imaging techniques. The presence of iodine atoms enhances its radiopacity, making it useful in various diagnostic procedures. The hydroxyl group contributes to its solubility and reactivity, allowing for potential interactions in biological systems. Additionally, the compound's structural features may influence its biological activity, including antimicrobial or anticancer properties. Its synthesis typically involves multi-step reactions, including halogenation and esterification processes. As with many iodinated compounds, care must be taken regarding its environmental impact and biological effects, particularly concerning iodine's role in thyroid function. Overall, this compound exemplifies the intersection of organic chemistry and pharmacology, highlighting the importance of halogenated compounds in modern science.

Formula:C₁₃H₆I₄O₄

InChI:InChI=1/C13H6I4O4/c14-7-3-6(4-8(15)11(7)18)21-12-9(16)1-5(13(19)20)2-10(12)17/h1-4,18H,(H,19,20)

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 4-(4-hydroxy-3,5-diiodophenoxy)-3,5-diiodo- REF: IN-DA002A4LCAS: 2055-97-2	97%	To inquire	Thu 27 Mar 25
Levothyroxine EP Impurity H REF: 4Z-L-4612CAS: 2055-97-2	- - -	631.00 €~4,405.00 €	Fri 28 Mar 25
3,3',5,5'-Tetraiodo Thyroformic Acid (>90%) REF: TR-T296150CAS: 2055-97-2	>90%	284.00 €~1,892.00 €	Tue 08 Apr 25
3,3',5,5'-Tetraiodothyroformic acid REF: 3D-FT66242CAS: 2055-97-2	Min. 95 Area-%	136.00 €~1,225.00 €	Mon 07 Apr 25
Thyroxine T4-Benzoic Acid REF: 45-1A10830CAS: 2055-97-2	- - -	- - -	Discontinued product