CAS 20611-21-6: 2-(Phenylsulfonyl)ethanol
Description:2-(Phenylsulfonyl)ethanol, with the CAS number 20611-21-6, is an organic compound characterized by the presence of a phenylsulfonyl group attached to an ethanol backbone. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It features a sulfonyl functional group, which contributes to its reactivity and potential applications in organic synthesis, particularly in the formation of sulfonamide derivatives. The hydroxyl group (-OH) in the ethanol moiety provides the compound with polar characteristics, enhancing its solubility in polar solvents. Additionally, the presence of the phenyl group can influence its electronic properties and steric hindrance, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Due to its functional groups, 2-(Phenylsulfonyl)ethanol may also exhibit biological activity, although specific biological properties would require further investigation. Overall, this compound serves as a valuable intermediate in synthetic organic chemistry.
Formula:C8H10O3S
InChI:InChI=1S/C8H10O3S/c9-6-7-12(10,11)8-4-2-1-3-5-8/h1-5,9H,6-7H2
InChI key:InChIKey=PQVYYVANSPZIKE-UHFFFAOYSA-N
SMILES:O=S(=O)(C=1C=CC=CC1)CCO
- Synonyms:
- 2-(Benzenesulfonyl)ethan-1-ol
- 2-(Benzenesulfonyl)ethanol
- 2-Hydroxyethyl phenyl sulfone
- Ethanol, 2-(phenylsulfonyl)-
- Phenyl 2-hydroxyethyl sulfoxide
- β-(Phenylsulfonyl)ethanol
- 2-(Phenylsulfonyl)ethanol
Ref: IN-DA002AIQ
| Undefined size | To inquire |
2-(Phenylsulfonyl)ethanol
Ref: 10-F003120
| 5g | 134.00 € |
Ethanol, 2-(phenylsulfonyl)-
Ref: 3D-VAA61121
| 1g | 737.00 € | ||
| 5g | To inquire | ||
| 10g | To inquire | ||
| 25g | To inquire | ||
| 50g | To inquire | ||
| 100g | To inquire | ||
| 100mg | 198.00 € |
