CAS 206258-97-1: Ethyl 8-bromo-4-chloroquinoline-3-carboxylate

Description:Ethyl 8-bromo-4-chloroquinoline-3-carboxylate is a chemical compound characterized by its quinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom. This substance features a carboxylate functional group, which contributes to its reactivity and solubility properties. The presence of bromine and chlorine substituents on the quinoline ring enhances its potential for various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks. Ethyl 8-bromo-4-chloroquinoline-3-carboxylate is typically used in organic synthesis and medicinal chemistry, where it may serve as an intermediate in the development of pharmaceuticals or agrochemicals. Its unique combination of halogen atoms and the carboxylate group may impart specific biological activities, making it a subject of interest in drug discovery. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, can vary based on its purity and the conditions under which it is handled. Safety precautions should be observed when working with this compound due to the presence of halogens, which can pose health risks.

Formula:C₁₂H₉BrClNO₂

InChI:InChI=1/C12H9BrClNO2/c1-2-17-12(16)8-6-15-11-7(10(8)14)4-3-5-9(11)13/h3-6H,2H2,1H3

Synonyms:
3-Quinolinecarboxylic acid, 8-bromo-4-chloro-, ethyl ester
Ethyl 4-chloro-8-bromoquinoline-3-carboxylate

Found 4 products.

Product data	Purity	Price range	Estimated delivery
3-Quinolinecarboxylic acid, 8-bromo-4-chloro-, ethyl ester REF: IN-DA002IDSCAS: 206258-97-1	97%	30.00 €~605.00 €	Thu 27 Mar 25
8-Bromo-4-chloroquinoline-3-carboxylic acid ethyl ester REF: 54-OR309352CAS: 206258-97-1	97%	32.00 €~1,731.00 €	Fri 28 Mar 25
Ethyl 8-bromo-4-chloroquinoline-3-carboxylate REF: 10-F091750CAS: 206258-97-1	95.0%	To inquire	Tue 08 Apr 25
Ethyl 8-bromo-4-chloroquinoline-3-carboxylate REF: 3D-FE44085CAS: 206258-97-1	Min. 95%	- - -	Discontinued product