CAS 20633-67-4: calycosin-7-o-beta-d-glucoside
Description:Calycosin-7-O-beta-D-glucoside is a naturally occurring flavonoid glycoside, primarily derived from the roots of the Astragalus species, particularly Astragalus membranaceus. This compound is characterized by its structure, which consists of a calycosin moiety linked to a glucose molecule via a beta-glycosidic bond. It exhibits various biological activities, including antioxidant, anti-inflammatory, and potential anticancer properties, making it of interest in pharmacological research. The compound is soluble in polar solvents, and its stability can be influenced by factors such as pH and temperature. Calycosin-7-O-beta-D-glucoside is often studied for its potential health benefits and therapeutic applications, particularly in traditional medicine. Its presence in herbal formulations highlights its significance in natural product chemistry and the exploration of plant-derived compounds for health and wellness. As with many flavonoids, it may also contribute to the color and flavor profiles of the plants from which it is extracted.
Formula:C22H22O10
InChI:InChI=1/C22H22O10/c1-29-15-5-2-10(6-14(15)24)13-9-30-16-7-11(3-4-12(16)18(13)25)31-22-21(28)20(27)19(26)17(8-23)32-22/h2-7,9,17,19-24,26-28H,8H2,1H3/t17-,19-,20+,21-,22-/m1/s1
- Synonyms:
- 3-(3-Hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-yl beta-D-glucopyranoside
- 4H-1-benzopyran-4-one, 7-(beta-D-glucopyranosyloxy)-3-(3-hydroxy-4-methoxyphenyl)-
- Calycosin-O-Glucopyranoside
- Calycosin 7-O-Glucoside
- Calycosin 7-O-β-D-glucopyranoside