CAS 206347-30-0: 7-bromo-2,3-dihydrobenzofuran

Description:7-Bromo-2,3-dihydrobenzofuran is an organic compound characterized by its unique bicyclic structure, which consists of a benzofuran core with a bromine substituent at the 7-position. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The presence of the bromine atom introduces both electrophilic and nucleophilic characteristics, making it a useful intermediate in various organic synthesis reactions. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with brominated compounds. Additionally, the dihydrobenzofuran moiety can influence the compound's solubility and stability, affecting its behavior in different chemical environments. As with many brominated compounds, care should be taken regarding its handling and disposal, considering the environmental and health implications associated with halogenated organic substances. Overall, 7-bromo-2,3-dihydrobenzofuran is a compound of interest in both synthetic and applied chemistry contexts.

Formula:C₈H₇BrO

InChI:InChI=1/C8H7BrO/c9-7-3-1-2-6-4-5-10-8(6)7/h1-3H,4-5H2

Synonyms:
7-Bromo-2,3-Dihydro-1-Benzofuran

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Benzofuran, 7-bromo-2,3-dihydro- REF: IN-DA002IG1CAS: 206347-30-0	95%	To inquire	Thu 27 Mar 25
7-Bromo-2,3-dihydrobenzofuran REF: 54-OR346457CAS: 206347-30-0	97+%	32.00 €~829.00 €	Fri 28 Mar 25
7-Bromo-2,3-dihydrobenzofuran REF: 10-F092459CAS: 206347-30-0	95.0%	20.00 €~503.00 €	Tue 01 Apr 25
7-Bromo-2,3-dihydrobenzofuran REF: 3D-FB42063CAS: 206347-30-0	Min. 95%	- - -	Discontinued product