CAS 207739-72-8: N,N,N',N',N'',N'',N''',N'''-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine
Description:N,N,N',N',N'',N'',N''',N'''-octakis(4-methoxyphenyl)-9,9'-spirobi[fluorene]-2,2',7,7'-tetramine is a complex organic compound characterized by its unique molecular structure, which includes multiple methoxyphenyl groups attached to a spirobi[fluorene] core. This compound features a high degree of symmetry and a significant number of functional groups, which can influence its solubility, reactivity, and potential applications in materials science and organic electronics. The presence of amine groups suggests potential for hydrogen bonding and reactivity in various chemical environments. Additionally, the methoxy substituents may enhance the compound's electronic properties, making it suitable for applications in organic light-emitting diodes (OLEDs) or as a building block in organic photovoltaics. The compound's intricate structure and functionalization can also lead to interesting photophysical properties, which are valuable in the development of advanced materials. Overall, this substance exemplifies the complexity and versatility found in modern organic chemistry.
Formula:C81H68N4O8
InChI:InChI=1/C81H68N4O8/c1-86-65-29-9-53(10-30-65)82(54-11-31-66(87-2)32-12-54)61-25-45-73-74-46-26-62(83(55-13-33-67(88-3)34-14-55)56-15-35-68(89-4)36-16-56)50-78(74)81(77(73)49-61)79-51-63(84(57-17-37-69(90-5)38-18-57)58-19-39-70(91-6)40-20-58)27-47-75(79)76-48-28-64(52-80(76)81)85(59-21-41-71(92-7)42-22-59)60-23-43-72(93-8)44-24-60/h9-52H,1-8H3
- Synonyms:
- 2,2',7,7'-Tetrakis[N,N-di(4-methoxyphenyl)amino]-9,9'-spirobifluorene
- 2,2',7,7'-tetrakis(N,N-di-p-methoxyphenylamino)-9,9'-spirobifluorene
- Lt-S922
- Spiro-MeOTAD