CAS 20776-60-7: 2-amino-5,6-dichlorobenzoic acid

Description:2-Amino-5,6-dichlorobenzoic acid is an aromatic compound characterized by the presence of an amino group (-NH2) and two chlorine atoms substituted on a benzoic acid structure. This compound features a carboxylic acid group (-COOH) that contributes to its acidic properties. The chlorine substituents are located at the 5 and 6 positions of the benzene ring, which can influence the compound's reactivity and solubility. Typically, such halogenated amino acids exhibit moderate to high solubility in polar solvents due to the presence of the carboxylic acid and amino groups, while their aromatic nature may impart some hydrophobic characteristics. This compound may be used in various applications, including pharmaceuticals and agrochemicals, due to its potential biological activity. Additionally, the presence of chlorine atoms can enhance the compound's stability and alter its interaction with biological systems. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula:C₇H₅Cl₂NO₂

InChI:InChI=1/C7H5Cl2NO2/c8-3-1-2-4(10)5(6(3)9)7(11)12/h1-2H,10H2,(H,11,12)

Synonyms:
6-Amino-2,3-Dichlorobenzoic Acid

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 6-amino-2,3-dichloro- REF: IN-DA002J9GCAS: 20776-60-7	95%	To inquire	Thu 27 Mar 25
6-Amino-2,3-dichlorobenzoic acid REF: 10-F731207CAS: 20776-60-7	95+%	- - -	Discontinued product
2-Amino-5,6-dichlorobenzoic acid REF: 3D-FA166925CAS: 20776-60-7	Min. 95%	- - -	Discontinued product