CAS 20780-75-0: 4-Iodoisatin

Description:4-Iodoisatin is a chemical compound that belongs to the class of isatins, which are derived from indole and characterized by a diketopiperazine structure. It features an iodine atom substituted at the 4-position of the isatin ring, which contributes to its unique reactivity and properties. The compound typically appears as a solid and is known for its potential biological activities, including antimicrobial and anticancer properties. 4-Iodoisatin can participate in various chemical reactions, such as nucleophilic substitutions and cyclizations, making it a valuable intermediate in organic synthesis. Its solubility can vary depending on the solvent, and it is often used in research settings to explore its pharmacological effects and as a building block for more complex molecules. Additionally, the presence of the iodine atom can enhance the compound's lipophilicity, influencing its interaction with biological systems. Overall, 4-Iodoisatin is a significant compound in medicinal chemistry and synthetic organic chemistry due to its diverse applications and interesting chemical behavior.

Formula:C₈H₄INO₂

InChI:InChI=1S/C8H4INO2/c9-4-2-1-3-5-6(4)7(11)8(12)10-5/h1-3H,(H,10,11,12)

InChI key:InChIKey=NYWOXCHAPWQNFC-UHFFFAOYSA-N

SMILES:O=C1NC=2C=CC=C(I)C2C1=O

Synonyms:
1H-Indole-2,3-dione, 4-iodo-
4-Iodo-1H-indole-2,3-dione
4-Iodoisatin
Indole-2,3-dione, 4-iodo-
Isatin, 4-iodo-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-Indole-2,3-dione, 4-iodo- REF: IN-DA002JAQCAS: 20780-75-0	97%	32.00 €~492.00 €	Thu 27 Mar 25
4-Iodoindoline-2,3-dione REF: 54-OR471590CAS: 20780-75-0	By hplc: 98.8% by area (Typical Value in Batch COA)	54.00 €~225.00 €	Fri 28 Mar 25
4-Iodoindoline-2,3-dione REF: 10-F091652CAS: 20780-75-0	95.0%	38.00 €~108.00 €	Tue 01 Apr 25
4-Iodoisatin REF: 3D-FI67680CAS: 20780-75-0	Min. 95%	167.00 €~896.00 €	Mon 07 Apr 25