CAS 207986-22-9: 2,3,6-trifluorobenzamide

Description:2,3,6-Trifluorobenzamide is an aromatic compound characterized by the presence of a benzene ring substituted with three fluorine atoms and an amide functional group. The fluorine atoms are located at the 2, 3, and 6 positions of the benzene ring, which significantly influences the compound's chemical properties, including its reactivity and polarity. The presence of the amide group contributes to its ability to form hydrogen bonds, affecting its solubility in various solvents. This compound is typically a solid at room temperature and may exhibit moderate stability under standard conditions. Its fluorinated structure can enhance its biological activity and lipophilicity, making it of interest in pharmaceutical research and development. Additionally, the trifluoromethyl groups can impart unique electronic properties, potentially affecting the compound's interaction with biological targets. Safety data should be consulted for handling and exposure guidelines, as fluorinated compounds can exhibit varying degrees of toxicity and environmental impact.

Formula:C₇H₄F₃NO

InChI:InChI=1/C7H4F3NO/c8-3-1-2-4(9)6(10)5(3)7(11)12/h1-2H,(H2,11,12)

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2,3,6-Trifluorobenzamide REF: 10-F008711CAS: 207986-22-9	97.0%	34.00 €~175.00 €	Tue 25 Mar 25
Benzamide, 2,3,6-trifluoro- REF: IN-DA002JEXCAS: 207986-22-9	95%	46.00 €~338.00 €	Thu 27 Mar 25
2,3,6-Trifluorobenzamide REF: 54-PC7265VCAS: 207986-22-9	97%	300.00 €	Thu 03 Apr 25
2,3,6-Trifluorobenzamide REF: 3D-FT77848CAS: 207986-22-9	Min. 95%	- - -	Discontinued product