CAS 20838-63-5: β-<span class="text-smallcaps">D</span>-Glucopyranosiduronic acid, phenyl, monosodium salt

Description:β-D-Glucopyranosiduronic acid, phenyl, monosodium salt is a chemical compound characterized by its structure, which includes a glucopyranosiduronic acid moiety linked to a phenyl group and exists as a monosodium salt. This compound typically exhibits properties associated with both carbohydrates and uronic acids, such as solubility in water and the ability to form hydrogen bonds due to the presence of hydroxyl groups. It is likely to participate in various biochemical interactions, making it relevant in fields like biochemistry and pharmaceuticals. The presence of the phenyl group may impart additional hydrophobic characteristics, influencing its behavior in biological systems. As a sodium salt, it may also exhibit enhanced stability and solubility compared to its free acid form. This compound can be utilized in research and development, particularly in studies related to glycosylation, drug formulation, and the exploration of carbohydrate-based therapeutics. Its specific applications and behavior would depend on the context of use and the conditions under which it is studied.

Formula:C₁₂H₁₄O₇·Na

InChI:InChI=1S/C12H14O7.Na/c13-7-8(14)10(11(16)17)19-12(9(7)15)18-6-4-2-1-3-5-6;/h1-5,7-10,12-15H,(H,16,17);/t7-,8-,9+,10-,12+;/m0./s1

InChI key:InChIKey=OBJZMDMNHLJHEL-BLKPXHQLSA-N

SMILES:[Na].O=C(O)C1OC(OC=2C=CC=CC2)C(O)C(O)C1O