CAS 208709-55-1: 1-Butoxy-2,3-difluoro-4-(trans-4-propylcyclohexyl)benzene
Description:1-Butoxy-2,3-difluoro-4-(trans-4-propylcyclohexyl)benzene is an organic compound characterized by its complex structure, which includes a butoxy group, two fluorine atoms, and a propylcyclohexyl substituent on a benzene ring. This compound features a hydrophobic aromatic system due to the benzene ring, which contributes to its potential applications in organic electronics and materials science. The presence of the butoxy group enhances its solubility in organic solvents, while the difluoro substituents can influence its electronic properties and reactivity. The trans-4-propylcyclohexyl group introduces steric effects that may affect the compound's conformation and interactions with other molecules. Overall, the unique combination of functional groups and structural features suggests that this compound may exhibit interesting physical and chemical properties, making it a candidate for further research in various fields, including pharmaceuticals and advanced materials. However, specific properties such as boiling point, melting point, and reactivity would require empirical data for precise characterization.
Formula:C19H28F2O
InChI:InChI=1/C19H28F2O/c1-3-5-13-22-17-12-11-16(18(20)19(17)21)15-9-7-14(6-4-2)8-10-15/h11-12,14-15H,3-10,13H2,1-2H3/t14-,15-
InChI key:InChIKey=KYNDSYARZOJNCG-SHTZXODSNA-N
SMILES:FC1=C(F)C(=CC=C1OCCCC)C2CCC(CCC)CC2
- Synonyms:
- 1-Butoxy-2,3-difluoro-4-(trans-4-propylcyclohexyl)benzene
- 3-Hb(2F,3F)-O4
- 3Cwo4
- Benzene, 1-Butoxy-2,3-Difluoro-4-(Trans-4-Propylcyclohexyl)-
- Butyl 2,3-difluoro-4-(trans-4-propylcyclohexyl)phenyl ether
- Cpff3O4
- Cy-3-O4
- Pch 304Ff
