CAS 2089649-44-3: 1H-Indene-1-carboxylic acid, 1-amino-5-bromo-4-fluoro-2,3-dihydro-, ethyl ester, hydrochloride (1:1)
Description:1H-Indene-1-carboxylic acid, 1-amino-5-bromo-4-fluoro-2,3-dihydro-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes an indene ring fused with a carboxylic acid and an amino group, along with halogen substituents (bromine and fluorine). This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid and hydrochloride functionalities. The presence of the amino group suggests potential for hydrogen bonding, which can influence its reactivity and solubility. The ethyl ester moiety indicates that it may undergo hydrolysis to release the corresponding carboxylic acid. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and spectral characteristics, would need to be determined through experimental methods or detailed literature review, as they are not universally defined for all compounds.
Formula:C12H13BrFNO2·ClH
InChI:InChI=1S/C12H13BrFNO2.ClH/c1-2-17-11(16)12(15)6-5-7-8(12)3-4-9(13)10(7)14;/h3-4H,2,5-6,15H2,1H3;1H
InChI key:InChIKey=FTVSIVQZIFHALZ-UHFFFAOYSA-N
SMILES:Cl.O=C(OCC)C1(N)C2=CC=C(Br)C(F)=C2CC1
- Synonyms:
- 1H-Indene-1-carboxylic acid, 1-amino-5-bromo-4-fluoro-2,3-dihydro-, ethyl ester, hydrochloride (1:1)
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Ethyl 1-amino-5-bromo-4-fluoro-2,3-dihydro-1H-indene-1-carboxylate hydrochloride REF: 10-F720045CAS: 2089649-44-3 | 95% | - - - | Discontinued product |
 | Ethyl 1-amino-5-bromo-4-fluoro-2,3-dihydroindene-1-carboxylate hydrochloride REF: 3D-PID64944CAS: 2089649-44-3 | Min. 95% | - - - | Discontinued product |
Ethyl 1-amino-5-bromo-4-fluoro-2,3-dihydro-1H-indene-1-carboxylate hydrochloride
Ref: 10-F720045
| 1g | Discontinued | Request information |
Ethyl 1-amino-5-bromo-4-fluoro-2,3-dihydroindene-1-carboxylate hydrochloride
Ref: 3D-PID64944
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
