
CAS 209394-29-6: (3S)-2,3-Dihydro-3-(2-propyn-1-ylamino)-1H-inden-5-yl N-ethyl-N-methylcarbamate
Description:(3S)-2,3-Dihydro-3-(2-propyn-1-ylamino)-1H-inden-5-yl N-ethyl-N-methylcarbamate is a chemical compound characterized by its complex structure, which includes an indene core, a carbamate functional group, and an alkyne substituent. The presence of the chiral center at the 3-position of the indene ring indicates that this compound can exist in enantiomeric forms, which may exhibit different biological activities. The carbamate moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as carbamates are often involved in enzyme inhibition and neurotransmitter modulation. Additionally, the alkyne group may provide opportunities for further chemical modifications or coupling reactions. The compound's solubility, stability, and reactivity would depend on its specific functional groups and the overall molecular architecture. As with many organic compounds, its properties can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.
Formula:C16H20N2O2
InChI:InChI=1S/C16H20N2O2/c1-4-10-17-15-9-7-12-6-8-13(11-14(12)15)20-16(19)18(3)5-2/h1,6,8,11,15,17H,5,7,9-10H2,2-3H3/t15-/m0/s1
InChI key:InChIKey=LHXOCOHMBFOVJS-HNNXBMFYSA-N
SMILES:O=C(OC1=CC=C2C(=C1)C(NCC#C)CC2)N(C)CC
- Synonyms:
- Carbamic acid, N-ethyl-N-methyl-, (3S)-2,3-dihydro-3-(2-propyn-1-ylamino)-1H-inden-5-yl ester
- TV 3279
- (3S)-2,3-Dihydro-3-(2-propyn-1-ylamino)-1H-inden-5-yl N-ethyl-N-methylcarbamate
- Carbamic acid, ethylmethyl-, (3S)-2,3-dihydro-3-(2-propynylamino)-1H-inden-5-yl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | TV 3279 REF: TM-T77332CAS: 209394-29-6 | 97% | 115.00 €~3,464.00 € | Fri 28 Mar 25 |

TV 3279
Ref: TM-T77332
1mg | 115.00 € | ||
5mg | 250.00 € | ||
10mg | 369.00 € | ||
25mg | 562.00 € | ||
1mL*10mM (DMSO) | 235.00 € |