CAS 2096331-38-1: B-(3-Chloro-7-isoquinolinyl)boronic acid
Description:B-(3-Chloro-7-isoquinolinyl)boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a phenyl group that contains a chloro-substituted isoquinoline moiety. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The chloro substituent can influence its reactivity and solubility, while the isoquinoline structure may impart specific biological activities or interactions. Boronic acids are known for their role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. Additionally, the presence of the isoquinoline ring may enhance the compound's potential as a pharmacophore in drug development. Overall, B-(3-Chloro-7-isoquinolinyl)boronic acid is a versatile compound with significant implications in synthetic organic chemistry and potential therapeutic applications.
Formula:C9H7BClNO2
InChI:InChI=1S/C9H7BClNO2/c11-9-4-6-1-2-8(10(13)14)3-7(6)5-12-9/h1-5,13-14H
InChI key:InChIKey=LFDFGQMNAXLLIK-UHFFFAOYSA-N
SMILES:ClC=1N=CC2=CC(=CC=C2C1)B(O)O
- Synonyms:
- Boronic acid, B-(3-chloro-7-isoquinolinyl)-
- B-(3-Chloro-7-isoquinolinyl)boronic acid
3-Chloroisoquinoline-7-boronic acid
Ref: IN-DA01FGI5
| Undefined size | To inquire |
Ref: FT-C14031
| 250mg | To inquire | ||
| 500mg | To inquire |
3-Chloroisoquinoline-7-boronic acid
Ref: 54-OR300006
| Undefined size | To inquire |
3-Chloroisoquinolin-7-boronic acid
Ref: 10-F623700
| 1g | To inquire |
3-Chloroisoquinoline-7-boronic acid
Ref: 3D-WID33138
| 1g | Discontinued | Request information | |
| 10mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
