
CAS 2097068-63-6: 3-Pyrrolidinecarboxylic acid, 5-phenyl-, ethyl ester, hydrochloride (1:1)
Description:3-Pyrrolidinecarboxylic acid, 5-phenyl-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which contributes to its cyclic amine properties. This compound features a carboxylic acid functional group and an ethyl ester moiety, indicating it has both acidic and ester functionalities. The presence of the phenyl group enhances its aromatic characteristics, potentially influencing its solubility and reactivity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Its molecular interactions can be influenced by the presence of the hydrochloride, affecting its pharmacokinetics and pharmacodynamics. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C13H17NO2·ClH
InChI:InChI=1S/C13H17NO2.ClH/c1-2-16-13(15)11-8-12(14-9-11)10-6-4-3-5-7-10;/h3-7,11-12,14H,2,8-9H2,1H3;1H
InChI key:InChIKey=BXNQKJOCJLIOCA-UHFFFAOYSA-N
SMILES:Cl.O=C(OCC)C1CNC(C=2C=CC=CC2)C1
- Synonyms:
- 3-Pyrrolidinecarboxylic acid, 5-phenyl-, ethyl ester, hydrochloride (1:1)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 5-Phenyl-pyrrolidine-3-carboxylic acid ethyl ester hydrochloride REF: 10-F736922CAS: 2097068-63-6 | 97% | - - - | Discontinued product |
![]() | 5-Phenyl-pyrrolidine-3-carboxylic acid ethyl ester hydrochloride REF: 3D-XID06863CAS: 2097068-63-6 | Min. 95% | - - - | Discontinued product |

5-Phenyl-pyrrolidine-3-carboxylic acid ethyl ester hydrochloride
Ref: 10-F736922
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |

5-Phenyl-pyrrolidine-3-carboxylic acid ethyl ester hydrochloride
Ref: 3D-XID06863
500mg | Discontinued | Request information |