CAS 2101944-51-6: [C(E)]-8-Bromo-5-quinoxalinecarboxaldehyde oxime

Description:[C(E)]-8-Bromo-5-quinoxalinecarboxaldehyde oxime is a chemical compound characterized by its unique structural features, which include a quinoxaline core, a bromine substituent, and an oxime functional group. The presence of the bromine atom typically enhances the compound's reactivity and may influence its biological activity. The oxime functional group, derived from the reaction of an aldehyde with hydroxylamine, is known for its ability to form stable complexes with metal ions and can participate in various chemical reactions, including condensation and rearrangement. This compound may exhibit properties such as fluorescence or photochemical activity, depending on its specific electronic structure. Additionally, quinoxaline derivatives are often studied for their potential applications in medicinal chemistry, particularly as antimicrobial or anticancer agents. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, making it a subject of interest in both synthetic and applied chemistry research.

Formula:C₉H₆BrN₃O

InChI:InChI=1S/C9H6BrN3O/c10-7-2-1-6(5-13-14)8-9(7)12-4-3-11-8/h1-5,14H/b13-5+

InChI key:InChIKey=SAGDWOSNXKALGN-WLRTZDKTSA-N

SMILES:BrC=1C=CC(C=NO)=C2N=CC=NC12