CAS 21026-77-7: 6',7',10,11-tetramethoxyemetan
Description:6',7',10,11-tetramethoxyemetan, identified by its CAS number 21026-77-7, is a chemical compound characterized by the presence of four methoxy (-OCH3) groups attached to a central emetan structure. This compound is part of a larger class of organic molecules known for their diverse applications in fields such as pharmaceuticals and agrochemicals. The methoxy groups contribute to the compound's solubility and reactivity, influencing its interaction with biological systems and other chemical entities. Typically, compounds with multiple methoxy substituents exhibit interesting properties, including altered electronic characteristics and enhanced lipophilicity, which can affect their bioavailability and pharmacokinetics. The specific arrangement of substituents in 6',7',10,11-tetramethoxyemetan may also play a crucial role in determining its biological activity and potential therapeutic applications. As with many organic compounds, the stability, reactivity, and overall behavior of this substance can be influenced by environmental factors such as pH, temperature, and the presence of other chemicals.
Formula:C29H41BrN2O4
InChI:InChI=1/C29H40N2O4.BrH/c1-6-18-17-31-10-8-20-14-27(33-3)29(35-5)16-23(20)25(31)12-21(18)11-24-22-15-28(34-4)26(32-2)13-19(22)7-9-30-24;/h13-16,18,21,24-25,30H,6-12,17H2,1-5H3;1H/t18-,21-,24-,25-;/m1./s1
- Synonyms:
- 2H-Benzo(a)quinolizine, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-((1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolyl)methyl)-
- 2H-benzo[a]quinolizine, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-[(1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolinyl)methyl]-
- 3-Ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy-2-((1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolyl)methyl)-2H-benzo[a]quinolizine
- 2-[(6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-1-yl)methyl]-3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-pyrido[2,1-a]isoquinoline hydrobromide
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Isoemetine hydrobromide REF: 7W-GY9540CAS: 21026-77-7 | ≥ 98.0% | To inquire | Fri 28 Mar 25 |
![]() | Isoemetine hydrobromide REF: BP-BP4511CAS: 21026-77-7 | 95%~99% | To inquire | Tue 01 Apr 25 |

Isoemetine hydrobromide
Ref: 7W-GY9540
Undefined size | To inquire |