CAS 21134-38-3: Acryloxymethyl Trimethoxysilane
Description:Acryloxymethyl Trimethoxysilane, with the CAS number 21134-38-3, is a silane coupling agent that features both organic and inorganic components, making it valuable in various applications, particularly in the fields of adhesives, coatings, and sealants. This compound typically exhibits a clear to pale yellow liquid appearance and has a characteristic odor. It is known for its ability to enhance adhesion between organic polymers and inorganic substrates, such as glass, metals, and ceramics, due to its reactive silane groups. The presence of the acryloxy functional group allows for further polymerization, enabling it to form cross-linked networks when cured, which can improve mechanical properties and chemical resistance. Acryloxymethyl Trimethoxysilane is also soluble in organic solvents and can hydrolyze in the presence of moisture, leading to the formation of silanol groups that can further react with other materials. Safety precautions should be observed when handling this compound, as it may cause irritation to the skin and eyes.
Formula:C7H14O5Si
InChI:InChI=1S/C7H14O5Si/c1-5-7(8)12-6-13(9-2,10-3)11-4/h5H,1,6H2,2-4H3
InChI key:InChIKey=JPPHEZSCZWYTOP-UHFFFAOYSA-N
SMILES:O=C(OC[Si](OC)(OC)OC)C=C
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | ACRYLOXYMETHYLTRIMETHOXYSILANE REF: 3H-SIA0182.0CAS: 21134-38-3 | 97% | To inquire | Tue 08 Apr 25 |
![]() | Acryloxymethyltrimethoxysilane REF: 10-S25019CAS: 21134-38-3 | - - - | - - - | Discontinued product |
![]() | (Trimethoxysilyl)methyl acrylate REF: 3D-WAA13438CAS: 21134-38-3 | Min. 95% | - - - | Discontinued product |

ACRYLOXYMETHYLTRIMETHOXYSILANE
Ref: 3H-SIA0182.0
25g | To inquire | ||
500g | To inquire |

Acryloxymethyltrimethoxysilane
Ref: 10-S25019
25g | Discontinued | Request information |

(Trimethoxysilyl)methyl acrylate
Ref: 3D-WAA13438
1kg | Discontinued | Request information | |
2kg | Discontinued | Request information |