CAS 2121513-06-0: B-(4-Formyl-2,5-dimethylphenyl)boronic acid

Description: B-(4-Formyl-2,5-dimethylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and an aldehyde moiety. This compound features a phenyl ring substituted with both a formyl group and two methyl groups, which contribute to its unique reactivity and solubility properties. The boronic acid group is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and materials science. The presence of the formyl group suggests potential reactivity in condensation reactions, while the methyl substituents can influence the compound's steric and electronic properties. This compound may also exhibit interesting properties in catalysis and as a building block in the synthesis of more complex organic molecules. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is handled and utilized. Overall, B-(4-Formyl-2,5-dimethylphenyl)boronic acid is a versatile compound with significant implications in synthetic organic chemistry.

Formula: C₉H₁₁BO₃

InChI: InChI=1S/C9H11BO3/c1-6-4-9(10(12)13)7(2)3-8(6)5-11/h3-5,12-13H,1-2H3

InChI key: InChIKey=MVQMHCCACPAQAM-UHFFFAOYSA-N

SMILES: O=CC=1C=C(C(=CC1C)B(O)O)C

Synonyms:

• Boronic acid, B-(4-formyl-2,5-dimethylphenyl)-
• B-(4-Formyl-2,5-dimethylphenyl)boronic acid

Boronic acid, B-(4-formyl-2,5-dimethylphenyl)-

CAS: 2121513-06-0

• Formula: C₉H₁₁BO₃
• Purity: 95%
• Molecular weight: 177.9928

2,5-Dimethyl-4-formylphenylboronic acid

CAS: 2121513-06-0

• Purity: 98%
• Molecular weight: 177.99000549316406