CAS 2121513-33-3: 7-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

Description: 7-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole is a chemical compound characterized by its unique structural features, which include an indazole core and a boron-containing dioxaborolane moiety. The presence of the methyl group at the 7-position of the indazole ring contributes to its hydrophobic characteristics, while the dioxaborolane group enhances its reactivity and potential for forming coordination complexes. This compound is likely to exhibit interesting properties such as solubility in organic solvents and potential applications in organic synthesis, particularly in the fields of medicinal chemistry and materials science. The boron atom in the dioxaborolane can participate in various chemical reactions, including cross-coupling reactions, making it a valuable building block in the synthesis of more complex molecules. Additionally, the compound's stability and reactivity can be influenced by the steric hindrance provided by the tetramethyl groups, which may affect its interactions with other chemical species. Overall, this compound represents a versatile structure with potential applications in various chemical research areas.

Formula: C₁₄H₁₉BN₂O₂

InChI: InChI=1S/C14H19BN2O2/c1-9-6-11(7-10-8-16-17-12(9)10)15-18-13(2,3)14(4,5)19-15/h6-8H,1-5H3,(H,16,17)

InChI key: InChIKey=WNAIFLGHMGJARG-UHFFFAOYSA-N

SMILES: N1=CC=2C=C(C=C(C2N1)C)B3OC(C)(C)C(O3)(C)C

Synonyms:

• 1H-Indazole, 7-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 7-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

(7-methyl-1H-indazol-5-yl)boronic acid

CAS: 2121513-33-3

• Formula: C₁₄H₁₉BN₂O₂
• Purity: %
• Color and Shape: Solid
• Molecular weight: 258.1239

7-Methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indazole

CAS: 2121513-33-3

• Purity: 98+%
• Molecular weight: 258.1300048828125

7-Methyl-1H-indazole-5-boronic acid pinacol ester

CAS: 2121513-33-3

Versatile small molecule scaffold

• Formula: C₁₄H₁₉BN₂O₂
• Purity: Min. 95%
• Molecular weight: 258.13 g/mol