CAS 21295-57-8: 6-(cyclohexylamino)-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione

Description:6-(Cyclohexylamino)-3-methyl-3H-dibenz[f,ij]isoquinoline-2,7-dione, with CAS number 21295-57-8, is a synthetic organic compound characterized by its complex polycyclic structure, which includes a dibenzisoquinoline framework. This compound features a cyclohexylamino group and a methyl substituent, contributing to its unique chemical properties. It is typically classified as a heterocyclic compound due to the presence of nitrogen in its structure. The presence of the dibenzisoquinoline moiety suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit biological activity. The compound may exhibit properties such as fluorescence or photochemical reactivity, depending on its electronic structure. Additionally, its solubility and stability can vary based on the solvent and environmental conditions. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its chemical behavior and potential applications.

Formula:C₂₃H₂₂N₂O₂

InChI:InChI=1S/C23H22N2O2/c1-25-19-12-11-18(24-14-7-3-2-4-8-14)22-21(19)17(13-20(25)26)15-9-5-6-10-16(15)23(22)27/h5-6,9-14,24H,2-4,7-8H2,1H3

InChI key:InChIKey=JZGUXCXDBKBCDN-UHFFFAOYSA-N

SMILES:O=C1C=C2C=3C=CC=CC3C(=O)C=4C(=CC=C(C24)N1C)NC5CCCCC5