CAS 213178-94-0: Cyclohexanepropanoic acid, α-amino-, hydrate (1:?), (αR)-
Description:Cyclohexanepropanoic acid, α-amino-, hydrate (1:?), (αR)-, with the CAS number 213178-94-0, is an organic compound characterized by its cyclohexane ring structure attached to a propanoic acid moiety and an amino group. This compound typically exhibits properties associated with both amino acids and carboxylic acids, such as the ability to form hydrogen bonds due to the presence of the amino and carboxylic acid functional groups. The hydrate form indicates that it can associate with water molecules, which may influence its solubility and stability in aqueous environments. The (αR)- designation refers to the specific stereochemistry of the amino acid, indicating the spatial arrangement of its substituents. This compound may be of interest in various fields, including pharmaceuticals and biochemistry, due to its potential biological activity and role as a building block in peptide synthesis. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and the presence of the hydrate.
Formula:C9H17NO2·xH2O
InChI:InChI=1S/C9H17NO2.H2O/c10-8(9(11)12)6-7-4-2-1-3-5-7;/h7-8H,1-6,10H2,(H,11,12);1H2/t8-;/m1./s1
InChI key:InChIKey=HDJQIWAIDCEDEF-DDWIOCJRSA-N
SMILES:O=C(O)C(N)CC1CCCCC1.O
- Synonyms:
- Cyclohexanepropanoic acid, α-amino-, hydrate, (αR)-
- Cyclohexanepropanoic acid, α-amino-, hydrate (1:?), (αR)-
