CAS 21406-61-1: Phosphonium, pentyltriphenyl-, bromide (1:1)
Description:Phosphonium, pentyltriphenyl-, bromide (1:1), with the CAS number 21406-61-1, is a quaternary ammonium salt characterized by a central phosphorus atom bonded to three phenyl groups and one pentyl group, along with a bromide counterion. This compound typically exhibits properties associated with phosphonium salts, such as high thermal stability and solubility in organic solvents. It is often used in organic synthesis and as a phase transfer catalyst due to its ability to facilitate the transfer of ions across organic and aqueous phases. The presence of the bulky triphenyl groups contributes to its steric hindrance, which can influence its reactivity and interaction with other chemical species. Additionally, the bromide ion serves as a counterion, which can be exchanged in various reactions, making this compound versatile in synthetic applications. Overall, pentyltriphenylphosphonium bromide is notable for its unique structural features and functional properties that are valuable in both academic and industrial chemistry contexts.
Formula:C23H26P·Br
InChI:InChI=1S/C23H26P.BrH/c1-2-3-13-20-24(21-14-7-4-8-15-21,22-16-9-5-10-17-22)23-18-11-6-12-19-23;/h4-12,14-19H,2-3,13,20H2,1H3;1H/q+1;/p-1
InChI key:InChIKey=VAUKWMSXUKODHR-UHFFFAOYSA-M
SMILES:[Br-].C=1C=CC(=CC1)[P+](C=2C=CC=CC2)(C=3C=CC=CC3)CCCCC
- Synonyms:
- Amyltriphenylphosphonium Bromide
- Bromo(pentyl)triphenylphosphorane
- Pentyl(triphenyl)phosphonium bromide
- Phosphonium, Pentyltriphenyl-, Bromide (1:1)
- Phosphonium, pentyltriphenyl-, bromide
- Pentyltriphenylphosphonium bromide
