CAS 2141-42-6: 1,2,3,4-Tetrahydroanthracene

Description:1,2,3,4-Tetrahydroanthracene is a polycyclic aromatic hydrocarbon characterized by its structure, which consists of a fused ring system derived from anthracene with four hydrogen atoms added, resulting in a saturated compound. This substance appears as a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively low volatility and moderate solubility in organic solvents. 1,2,3,4-Tetrahydroanthracene is primarily used as a solvent and in the synthesis of various organic compounds, including pharmaceuticals and polymers. Its chemical formula is C14H14, and it has a molecular weight that reflects its composition of carbon and hydrogen. The compound exhibits stability under standard conditions but may undergo reactions typical of aliphatic hydrocarbons, such as oxidation. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 1,2,3,4-Tetrahydroanthracene serves as an important intermediate in organic chemistry and materials science.

Formula:C₁₄H₁₄

InChI:InChI=1S/C14H14/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-2,5-6,9-10H,3-4,7-8H2

InChI key:InChIKey=XBDYBAVJXHJMNQ-UHFFFAOYSA-N

SMILES:C=1C=CC=2C=C3C(=CC2C1)CCCC3