CAS 214554-18-4: 2-Fluoro-4-(hydroxymethyl)benzoic acid

Description:2-Fluoro-4-(hydroxymethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of a fluorine atom and a hydroxymethyl group on the benzene ring. The fluorine substituent typically enhances the compound's reactivity and can influence its biological activity, while the hydroxymethyl group introduces a polar functional group that can participate in hydrogen bonding. This compound is likely to be a white to off-white solid at room temperature, with moderate solubility in polar solvents such as water and alcohols due to the presence of the hydroxymethyl and carboxylic acid groups. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, particularly in the development of biologically active compounds. The presence of both electron-withdrawing (fluoro) and electron-donating (hydroxymethyl) groups can also affect the acidity and reactivity of the carboxylic acid functional group, making it an interesting subject for further study in medicinal chemistry and materials science.

Formula:C₈H₇FO₃

InChI:InChI=1S/C8H7FO3/c9-7-3-5(4-10)1-2-6(7)8(11)12/h1-3,10H,4H2,(H,11,12)

InChI key:InChIKey=ZCRWSMHXYHEAQD-UHFFFAOYSA-N

SMILES:O=C(O)C1=CC=C(C=C1F)CO

Synonyms:
2-Fluoro-4-(hydroxymethyl)benzoic acid
Benzoic acid, 2-fluoro-4-(hydroxymethyl)-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-Fluoro-4-(hydroxymethyl)benzoic acid REF: IN-DA003H93CAS: 214554-18-4	96%	42.00 €~641.00 €	Thu 27 Mar 25
2-Fluoro-4-(hydroxymethyl)benzoic acid REF: 54-PC2809CAS: 214554-18-4	98%	54.00 €~623.00 €	Thu 03 Apr 25
2-Fluoro-4-(hydroxymethyl)benzoic acid REF: 10-F605427CAS: 214554-18-4	97%	To inquire	Tue 08 Apr 25
2-Fluoro-4-(Hydroxymethyl)Benzoic Acid REF: 3D-FF84449CAS: 214554-18-4	Min. 95%	- - -	Discontinued product