CAS 21573-29-5: 4-(acetylamino)-2-nitrobenzoic acid

Description:4-(Acetylamino)-2-nitrobenzoic acid, with the CAS number 21573-29-5, is an organic compound characterized by its aromatic structure, which includes a nitro group and an acetylamino group attached to a benzoic acid framework. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits both acidic and basic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The nitro group contributes to its electron-withdrawing characteristics, influencing its reactivity and stability. This compound is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or dyes. Additionally, its structural features may impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as compounds with nitro groups can be sensitive and potentially hazardous.

Formula:C₉H₈N₂O₅

InChI:InChI=1/C9H8N2O5/c1-5(12)10-6-2-3-7(9(13)14)8(4-6)11(15)16/h2-4H,1H3,(H,10,12)(H,13,14)

Synonyms:
4-Acetamido-2-nitrobenzoic acid
Benzoic Acid, 4-(Acetylamino)-2-Nitro-

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	4-(Acetylamino)-2-nitrobenzoic acid REF: 3D-FA131194CAS: 21573-29-5	Min. 95%	191.00 €~1,071.00 €	Mon 21 Apr 25
	4-(acetylamino)-2-nitrobenzoic acid REF: 10-F373466CAS: 21573-29-5	- - -	- - -	Discontinued product