CAS 21577-80-0: 1-Dodecyl 1,2-benzenedicarboxylate
Description:1-Dodecyl 1,2-benzenedicarboxylate, with the CAS number 21577-80-0, is an organic compound characterized by its structure, which includes a dodecyl (a 12-carbon alkyl) chain attached to a benzene ring that is further substituted with two carboxylate groups. This compound is typically classified as a diester, resulting from the esterification of dodecanol with phthalic acid. It exhibits hydrophobic properties due to the long alkyl chain, making it soluble in organic solvents while being less soluble in water. The presence of the carboxylate groups imparts some polar characteristics, which can influence its interactions in various chemical environments. This compound is often utilized in applications such as surfactants, plasticizers, and as a potential additive in polymer formulations. Its physical properties, such as melting point, boiling point, and density, can vary based on the specific conditions and purity of the sample. Overall, 1-Dodecyl 1,2-benzenedicarboxylate is notable for its unique balance of hydrophobic and polar characteristics, making it useful in various industrial applications.
Formula:C20H30O4
InChI:InChI=1S/C20H30O4/c1-2-3-4-5-6-7-8-9-10-13-16-24-20(23)18-15-12-11-14-17(18)19(21)22/h11-12,14-15H,2-10,13,16H2,1H3,(H,21,22)
InChI key:InChIKey=WGQVJOPQTOUKDI-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=CC=CC1C(=O)OCCCCCCCCCCCC
- Synonyms:
- 1,2-Benzenedicarboxylic acid, 1-dodecyl ester
- 1,2-Benzenedicarboxylic acid, monododecyl ester
- 1-Dodecyl 1,2-benzenedicarboxylate
- 2-(Dodecyloxycarbonyl)benzoic acid
- 2-[(Dodecyloxy)Carbonyl]Benzoic Acid
- Dodecyl phthalate
- Lauryl phthalate
- Monododecyl phthalate
- Monolauryl phthalate
- Phthalic acid, dodecyl ester
- See more synonyms
- Phthalic acid, monododecyl ester
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | mono-n-Dodecyl Phthalate-3,4,5,6-d4 REF: 3U-D7705CAS: 21577-80-0 | 99 atom % D | 290.00 €~506.00 € | Mon 31 Mar 25 |
![]() | Dodecyl Phthalate-d4 REF: TR-D525382CAS: 21577-80-0 | - - - | 277.00 € | Tue 08 Apr 25 |
![]() | Dodecyl Phthalate REF: TR-D525380CAS: 21577-80-0 | - - - | 805.00 € | Wed 07 May 25 |
![]() | Dodecyl phthalate REF: 3D-WAA57780CAS: 21577-80-0 | Min. 95% | - - - | Discontinued product |

mono-n-Dodecyl Phthalate-3,4,5,6-d4
Ref: 3U-D7705
50mg | 290.00 € | ||
100mg | 506.00 € |

Dodecyl Phthalate-d4
Controlled ProductRef: TR-D525382
5mg | 277.00 € |

Dodecyl Phthalate
Controlled ProductRef: TR-D525380
5g | 805.00 € |

Dodecyl phthalate
Ref: 3D-WAA57780
5mg | Discontinued | Request information | |
10mg | Discontinued | Request information | |
25mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information |